C26H33N3O3 — CID 59558029
N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(oxan-2-ylmethoxy)benzamide (PubChem CID 59558029) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(oxan-2-ylmethoxy)benzamide.
| Compound Name | N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(oxan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 59558029 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(oxan-2-ylmethoxy)benzamide |
| SMILES | CN1C[C@H]2CCN(c3ccc(NC(=O)c4ccc(OCC5CCCCO5)cc4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C26H33N3O3/c1-28-16-20-13-14-29(25(20)17-28)22-9-7-21(8-10-22)27-26(30)19-5-11-23(12-6-19)32-18-24-4-2-3-15-31-24/h5-12,20,24-25H,2-4,13-18H2,1H3,(H,27,30)/t20-,24?,25+/m1/s1 |
| InChIKey | INKIHQNNHKISNM-AXLDUTFISA-N |
| XLogP | 4.03 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |