C27H35N3O2 — CID 59558048
N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclohexylmethoxy)benzamide (PubChem CID 59558048) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclohexylmethoxy)benzamide.
| Compound Name | N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclohexylmethoxy)benzamide |
|---|---|
| PubChem CID | 59558048 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | N-[4-[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclohexylmethoxy)benzamide |
| SMILES | CN1C[C@@H]2CCN(c3ccc(NC(=O)c4ccc(OCC5CCCCC5)cc4)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C27H35N3O2/c1-29-17-22-15-16-30(26(22)18-29)24-11-9-23(10-12-24)28-27(31)21-7-13-25(14-8-21)32-19-20-5-3-2-4-6-20/h7-14,20,22,26H,2-6,15-19H2,1H3,(H,28,31)/t22-,26+/m0/s1 |
| InChIKey | XITDZBJSVDLSSK-BKMJKUGQSA-N |
| XLogP | 5.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |