C30H39N3O2 — CID 59558119
N-[4-[(3aR,6aR)-5-(cyclopentylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclobutyloxymethyl)benzamide (PubChem CID 59558119) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is N-[4-[(3aR,6aR)-5-(cyclopentylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclobutyloxymethyl)benzamide.
| Compound Name | N-[4-[(3aR,6aR)-5-(cyclopentylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclobutyloxymethyl)benzamide |
|---|---|
| PubChem CID | 59558119 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | N-[4-[(3aR,6aR)-5-(cyclopentylmethyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]-4-(cyclobutyloxymethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CC[C@@H]3CN(CC4CCCC4)C[C@@H]32)cc1)c1ccc(COC2CCC2)cc1 |
| InChI | InChI=1S/C30H39N3O2/c34-30(24-10-8-23(9-11-24)21-35-28-6-3-7-28)31-26-12-14-27(15-13-26)33-17-16-25-19-32(20-29(25)33)18-22-4-1-2-5-22/h8-15,22,25,28-29H,1-7,16-21H2,(H,31,34)/t25-,29+/m1/s1 |
| InChIKey | YWPPXLDWMOXRKQ-IRPSRAIASA-N |
| XLogP | 5.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |