C27H37N3O2 — CID 21105605
N-[4-[3-(cyclohexylamino)pyrrolidin-1-yl]phenyl]-4-(2-methylpropoxy)benzamide (PubChem CID 21105605) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-[4-[3-(cyclohexylamino)pyrrolidin-1-yl]phenyl]-4-(2-methylpropoxy)benzamide.
| Compound Name | N-[4-[3-(cyclohexylamino)pyrrolidin-1-yl]phenyl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 21105605 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | N-[4-[3-(cyclohexylamino)pyrrolidin-1-yl]phenyl]-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)Nc2ccc(N3CCC(NC4CCCCC4)C3)cc2)cc1 |
| InChI | InChI=1S/C27H37N3O2/c1-20(2)19-32-26-14-8-21(9-15-26)27(31)29-23-10-12-25(13-11-23)30-17-16-24(18-30)28-22-6-4-3-5-7-22/h8-15,20,22,24,28H,3-7,16-19H2,1-2H3,(H,29,31) |
| InChIKey | MNMBRKUUWPFQNQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|