C30H37N3O2 — CID 142931750
[4-[3-(2,3-dihydro-1H-inden-2-ylamino)pyrrolidin-1-yl]anilino]-[4-(2-methylpropoxy)phenyl]methanol (PubChem CID 142931750) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is [4-[3-(2,3-dihydro-1H-inden-2-ylamino)pyrrolidin-1-yl]anilino]-[4-(2-methylpropoxy)phenyl]methanol.
| Compound Name | [4-[3-(2,3-dihydro-1H-inden-2-ylamino)pyrrolidin-1-yl]anilino]-[4-(2-methylpropoxy)phenyl]methanol |
|---|---|
| PubChem CID | 142931750 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | [4-[3-(2,3-dihydro-1H-inden-2-ylamino)pyrrolidin-1-yl]anilino]-[4-(2-methylpropoxy)phenyl]methanol |
| SMILES | CC(C)COc1ccc(C(O)Nc2ccc(N3CCC(NC4Cc5ccccc5C4)C3)cc2)cc1 |
| InChI | InChI=1S/C30H37N3O2/c1-21(2)20-35-29-13-7-22(8-14-29)30(34)32-25-9-11-28(12-10-25)33-16-15-26(19-33)31-27-17-23-5-3-4-6-24(23)18-27/h3-14,21,26-27,30-32,34H,15-20H2,1-2H3 |
| InChIKey | WRMPBOLDECUDLY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|