C23H27N3O2S — CID 142931301
[5-(3-methoxyphenyl)thiophen-2-yl]-[4-[3-(methylamino)pyrrolidin-1-yl]anilino]methanol (PubChem CID 142931301) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is [5-(3-methoxyphenyl)thiophen-2-yl]-[4-[3-(methylamino)pyrrolidin-1-yl]anilino]methanol.
| Compound Name | [5-(3-methoxyphenyl)thiophen-2-yl]-[4-[3-(methylamino)pyrrolidin-1-yl]anilino]methanol |
|---|---|
| PubChem CID | 142931301 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [5-(3-methoxyphenyl)thiophen-2-yl]-[4-[3-(methylamino)pyrrolidin-1-yl]anilino]methanol |
| SMILES | CNC1CCN(c2ccc(NC(O)c3ccc(-c4cccc(OC)c4)s3)cc2)C1 |
| InChI | InChI=1S/C23H27N3O2S/c1-24-18-12-13-26(15-18)19-8-6-17(7-9-19)25-23(27)22-11-10-21(29-22)16-4-3-5-20(14-16)28-2/h3-11,14,18,23-25,27H,12-13,15H2,1-2H3 |
| InChIKey | SFMQRHQCTBCTQU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|