C24H27N3OS — CID 58866936
5-(3,4-dimethylphenyl)-N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]thiophene-2-carboxamide (PubChem CID 58866936) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58866936 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]thiophene-2-carboxamide |
| SMILES | CNC1CCN(c2ccc(NC(=O)c3ccc(-c4ccc(C)c(C)c4)s3)cc2)C1 |
| InChI | InChI=1S/C24H27N3OS/c1-16-4-5-18(14-17(16)2)22-10-11-23(29-22)24(28)26-19-6-8-21(9-7-19)27-13-12-20(15-27)25-3/h4-11,14,20,25H,12-13,15H2,1-3H3,(H,26,28) |
| InChIKey | ZPAJTCXCQWBDOZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|