C23H30N4O2 — CID 67147888
1-(4-cyclopentyloxyphenyl)-3-[4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]urea (PubChem CID 67147888) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]urea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 67147888 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[4-[(3S)-3-(methylamino)pyrrolidin-1-yl]phenyl]urea |
| SMILES | CN[C@H]1CCN(c2ccc(NC(=O)Nc3ccc(OC4CCCC4)cc3)cc2)C1 |
| InChI | InChI=1S/C23H30N4O2/c1-24-19-14-15-27(16-19)20-10-6-17(7-11-20)25-23(28)26-18-8-12-22(13-9-18)29-21-4-2-3-5-21/h6-13,19,21,24H,2-5,14-16H2,1H3,(H2,25,26,28)/t19-/m0/s1 |
| InChIKey | CCCAHLCWKFZPSO-IBGZPJMESA-N |
| XLogP | 4.45 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|