C25H33N5O2 — CID 91321572
N-[1-[4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]propanamide (PubChem CID 91321572) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[1-[4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]propanamide.
| Compound Name | N-[1-[4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 91321572 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[1-[4-[(4-piperidin-1-ylphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]propanamide |
| SMILES | CCC(=O)NC1CCN(c2ccc(NC(=O)Nc3ccc(N4CCCCC4)cc3)cc2)C1 |
| InChI | InChI=1S/C25H33N5O2/c1-2-24(31)26-21-14-17-30(18-21)23-12-8-20(9-13-23)28-25(32)27-19-6-10-22(11-7-19)29-15-4-3-5-16-29/h6-13,21H,2-5,14-18H2,1H3,(H,26,31)(H2,27,28,32) |
| InChIKey | NFDUJPUDXNBBQA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|