C34H41N5O5 — CID 152748891
N-[[1-[4-[(4-cyclopentyloxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]methyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide (PubChem CID 152748891) has the molecular formula C34H41N5O5 and a molecular weight of 599.73 g/mol. Its IUPAC name is N-[[1-[4-[(4-cyclopentyloxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]methyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[[1-[4-[(4-cyclopentyloxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]methyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 152748891 |
| Molecular Formula | C34H41N5O5 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | N-[[1-[4-[(4-cyclopentyloxyphenyl)carbamoylamino]phenyl]pyrrolidin-3-yl]methyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)cc1)Nc1ccc(N2CCC(CNC(=O)C3CCCN(C(=O)c4ccco4)C3)C2)cc1 |
| InChI | InChI=1S/C34H41N5O5/c40-32(25-5-3-18-39(23-25)33(41)31-8-4-20-43-31)35-21-24-17-19-38(22-24)28-13-9-26(10-14-28)36-34(42)37-27-11-15-30(16-12-27)44-29-6-1-2-7-29/h4,8-16,20,24-25,29H,1-3,5-7,17-19,21-23H2,(H,35,40)(H2,36,37,42) |
| InChIKey | AGZUVGBCNIZUIG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|