C16H17NO3 — CID 110605371
furan-2-yl-(3-phenoxypiperidin-1-yl)methanone (PubChem CID 110605371) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is furan-2-yl-(3-phenoxypiperidin-1-yl)methanone.
| Compound Name | furan-2-yl-(3-phenoxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 110605371 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | furan-2-yl-(3-phenoxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCCC(Oc2ccccc2)C1 |
| InChI | InChI=1S/C16H17NO3/c18-16(15-9-5-11-19-15)17-10-4-8-14(12-17)20-13-6-2-1-3-7-13/h1-3,5-7,9,11,14H,4,8,10,12H2 |
| InChIKey | CAOOVCKCNLIXHA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |