C18H21NO3 — CID 71860926
furan-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone (PubChem CID 71860926) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is furan-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone.
| Compound Name | furan-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 71860926 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | furan-2-yl-[3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCC(OCCCc2ccccc2)C1 |
| InChI | InChI=1S/C18H21NO3/c20-18(17-9-5-13-22-17)19-11-10-16(14-19)21-12-4-8-15-6-2-1-3-7-15/h1-3,5-7,9,13,16H,4,8,10-12,14H2 |
| InChIKey | UHKSNXRTGIGEKB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|