C21H24N2O3 — CID 119152144
4-[3-(3-phenylpropoxy)pyrrolidine-1-carbonyl]benzamide (PubChem CID 119152144) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[3-(3-phenylpropoxy)pyrrolidine-1-carbonyl]benzamide.
| Compound Name | 4-[3-(3-phenylpropoxy)pyrrolidine-1-carbonyl]benzamide |
|---|---|
| PubChem CID | 119152144 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[3-(3-phenylpropoxy)pyrrolidine-1-carbonyl]benzamide |
| SMILES | NC(=O)c1ccc(C(=O)N2CCC(OCCCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H24N2O3/c22-20(24)17-8-10-18(11-9-17)21(25)23-13-12-19(15-23)26-14-4-7-16-5-2-1-3-6-16/h1-3,5-6,8-11,19H,4,7,12-15H2,(H2,22,24) |
| InChIKey | CIMRBXXNWYGYLV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|