C21H23F2NO4S — CID 96530094
[4-(difluoromethylsulfonyl)phenyl]-[(3S)-3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone (PubChem CID 96530094) has the molecular formula C21H23F2NO4S and a molecular weight of 423.48 g/mol. Its IUPAC name is [4-(difluoromethylsulfonyl)phenyl]-[(3S)-3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone.
| Compound Name | [4-(difluoromethylsulfonyl)phenyl]-[(3S)-3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 96530094 |
| Molecular Formula | C21H23F2NO4S |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [4-(difluoromethylsulfonyl)phenyl]-[(3S)-3-(3-phenylpropoxy)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)C(F)F)cc1)N1CC[C@H](OCCCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23F2NO4S/c22-21(23)29(26,27)19-10-8-17(9-11-19)20(25)24-13-12-18(15-24)28-14-4-7-16-5-2-1-3-6-16/h1-3,5-6,8-11,18,21H,4,7,12-15H2/t18-/m0/s1 |
| InChIKey | VLEGYYPCOUNZJG-SFHVURJKSA-N |
| XLogP | 3.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|