C14H17F2NO3S — CID 78768168
[4-(difluoromethylsulfonyl)phenyl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 78768168) has the molecular formula C14H17F2NO3S and a molecular weight of 317.36 g/mol. Its IUPAC name is [4-(difluoromethylsulfonyl)phenyl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [4-(difluoromethylsulfonyl)phenyl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 78768168 |
| Molecular Formula | C14H17F2NO3S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [4-(difluoromethylsulfonyl)phenyl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(S(=O)(=O)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C14H17F2NO3S/c1-10-6-8-17(9-7-10)13(18)11-2-4-12(5-3-11)21(19,20)14(15)16/h2-5,10,14H,6-9H2,1H3 |
| InChIKey | QLKKWJNSRKQWIT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |