C16H21F2NO4S — CID 75399592
[4-(difluoromethylsulfonyl)phenyl]-[4-(methoxymethyl)-4-methylpiperidin-1-yl]methanone (PubChem CID 75399592) has the molecular formula C16H21F2NO4S and a molecular weight of 361.41 g/mol. Its IUPAC name is [4-(difluoromethylsulfonyl)phenyl]-[4-(methoxymethyl)-4-methylpiperidin-1-yl]methanone.
| Compound Name | [4-(difluoromethylsulfonyl)phenyl]-[4-(methoxymethyl)-4-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 75399592 |
| Molecular Formula | C16H21F2NO4S |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | [4-(difluoromethylsulfonyl)phenyl]-[4-(methoxymethyl)-4-methylpiperidin-1-yl]methanone |
| SMILES | COCC1(C)CCN(C(=O)c2ccc(S(=O)(=O)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H21F2NO4S/c1-16(11-23-2)7-9-19(10-8-16)14(20)12-3-5-13(6-4-12)24(21,22)15(17)18/h3-6,15H,7-11H2,1-2H3 |
| InChIKey | UYYFNLMYJRAADS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |