C19H26F2N2O4S — CID 55950780
N-butyl-1-[4-(difluoromethylsulfonyl)benzoyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55950780) has the molecular formula C19H26F2N2O4S and a molecular weight of 416.49 g/mol. Its IUPAC name is N-butyl-1-[4-(difluoromethylsulfonyl)benzoyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-butyl-1-[4-(difluoromethylsulfonyl)benzoyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55950780 |
| Molecular Formula | C19H26F2N2O4S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-butyl-1-[4-(difluoromethylsulfonyl)benzoyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)c2ccc(S(=O)(=O)C(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H26F2N2O4S/c1-3-4-11-22(2)17(24)15-9-12-23(13-10-15)18(25)14-5-7-16(8-6-14)28(26,27)19(20)21/h5-8,15,19H,3-4,9-13H2,1-2H3 |
| InChIKey | OXMJLEUUXIFHSI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |