C19H24F2N2O4S — CID 112767085
[1-[4-(difluoromethylsulfonyl)benzoyl]piperidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 112767085) has the molecular formula C19H24F2N2O4S and a molecular weight of 414.47 g/mol. Its IUPAC name is [1-[4-(difluoromethylsulfonyl)benzoyl]piperidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[4-(difluoromethylsulfonyl)benzoyl]piperidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 112767085 |
| Molecular Formula | C19H24F2N2O4S |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [1-[4-(difluoromethylsulfonyl)benzoyl]piperidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(S(=O)(=O)C(F)F)cc1)N1CCC(C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C19H24F2N2O4S/c20-19(21)28(26,27)16-6-4-14(5-7-16)17(24)23-12-8-15(9-13-23)18(25)22-10-2-1-3-11-22/h4-7,15,19H,1-3,8-13H2 |
| InChIKey | CTMDOYHUTPJRTD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |