C15H20F2N2O3S — CID 119594454
[3-(1-aminoethyl)piperidin-1-yl]-[4-(difluoromethylsulfonyl)phenyl]methanone (PubChem CID 119594454) has the molecular formula C15H20F2N2O3S and a molecular weight of 346.40 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[4-(difluoromethylsulfonyl)phenyl]methanone.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[4-(difluoromethylsulfonyl)phenyl]methanone |
|---|---|
| PubChem CID | 119594454 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[4-(difluoromethylsulfonyl)phenyl]methanone |
| SMILES | CC(N)C1CCCN(C(=O)c2ccc(S(=O)(=O)C(F)F)cc2)C1 |
| InChI | InChI=1S/C15H20F2N2O3S/c1-10(18)12-3-2-8-19(9-12)14(20)11-4-6-13(7-5-11)23(21,22)15(16)17/h4-7,10,12,15H,2-3,8-9,18H2,1H3 |
| InChIKey | KCOKHIYUOMLBER-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |