C23H34FN3O4S — CID 55836283
N-butyl-1-(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)-N-methylpiperidine-4-carboxamide (PubChem CID 55836283) has the molecular formula C23H34FN3O4S and a molecular weight of 467.61 g/mol. Its IUPAC name is N-butyl-1-(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | N-butyl-1-(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55836283 |
| Molecular Formula | C23H34FN3O4S |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | N-butyl-1-(4-fluoro-3-piperidin-1-ylsulfonylbenzoyl)-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H34FN3O4S/c1-3-4-12-25(2)22(28)18-10-15-26(16-11-18)23(29)19-8-9-20(24)21(17-19)32(30,31)27-13-6-5-7-14-27/h8-9,17-18H,3-7,10-16H2,1-2H3 |
| InChIKey | BRPNNYSQNAUTEM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |