C21H31ClN2O2 — CID 17119241
N,N-dibutyl-1-(4-chlorobenzoyl)piperidine-4-carboxamide (PubChem CID 17119241) has the molecular formula C21H31ClN2O2 and a molecular weight of 378.94 g/mol. Its IUPAC name is N,N-dibutyl-1-(4-chlorobenzoyl)piperidine-4-carboxamide.
| Compound Name | N,N-dibutyl-1-(4-chlorobenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17119241 |
| Molecular Formula | C21H31ClN2O2 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N,N-dibutyl-1-(4-chlorobenzoyl)piperidine-4-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H31ClN2O2/c1-3-5-13-23(14-6-4-2)21(26)18-11-15-24(16-12-18)20(25)17-7-9-19(22)10-8-17/h7-10,18H,3-6,11-16H2,1-2H3 |
| InChIKey | XLKFAGSFBCWMPE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |