C18H27N3O2 — CID 113005906
N,N-dipropyl-1-(pyridine-3-carbonyl)piperidine-4-carboxamide (PubChem CID 113005906) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is N,N-dipropyl-1-(pyridine-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N,N-dipropyl-1-(pyridine-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113005906 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N,N-dipropyl-1-(pyridine-3-carbonyl)piperidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-3-10-20(11-4-2)17(22)15-7-12-21(13-8-15)18(23)16-6-5-9-19-14-16/h5-6,9,14-15H,3-4,7-8,10-13H2,1-2H3 |
| InChIKey | RWXZXPJSHNOKRT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |