C20H30N2O3 — CID 113005887
1-(4-methoxybenzoyl)-N,N-dipropylpiperidine-4-carboxamide (PubChem CID 113005887) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-(4-methoxybenzoyl)-N,N-dipropylpiperidine-4-carboxamide.
| Compound Name | 1-(4-methoxybenzoyl)-N,N-dipropylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 113005887 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-(4-methoxybenzoyl)-N,N-dipropylpiperidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1CCN(C(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H30N2O3/c1-4-12-21(13-5-2)20(24)17-10-14-22(15-11-17)19(23)16-6-8-18(25-3)9-7-16/h6-9,17H,4-5,10-15H2,1-3H3 |
| InChIKey | SQVFEZDOGODGOI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |