C26H31ClN2O4 — CID 55950662
N-butyl-1-[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55950662) has the molecular formula C26H31ClN2O4 and a molecular weight of 471.00 g/mol. Its IUPAC name is N-butyl-1-[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-butyl-1-[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55950662 |
| Molecular Formula | C26H31ClN2O4 |
| Molecular Weight | 471.00 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-butyl-1-[2-[4-(4-chlorobenzoyl)phenoxy]acetyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)COc2ccc(C(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H31ClN2O4/c1-3-4-15-28(2)26(32)21-13-16-29(17-14-21)24(30)18-33-23-11-7-20(8-12-23)25(31)19-5-9-22(27)10-6-19/h5-12,21H,3-4,13-18H2,1-2H3 |
| InChIKey | SLVKZRARRUSKLB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |