C22H32ClN3O5S — CID 55887149
1-[4-(1-butylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 55887149) has the molecular formula C22H32ClN3O5S and a molecular weight of 486.03 g/mol. Its IUPAC name is 1-[4-(1-butylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[4-(1-butylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 55887149 |
| Molecular Formula | C22H32ClN3O5S |
| Molecular Weight | 486.03 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 1-[4-(1-butylsulfonylpiperidine-4-carbonyl)piperazin-1-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)N2CCN(C(=O)COc3ccc(Cl)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H32ClN3O5S/c1-2-3-16-32(29,30)26-10-8-18(9-11-26)22(28)25-14-12-24(13-15-25)21(27)17-31-20-6-4-19(23)5-7-20/h4-7,18H,2-3,8-17H2,1H3 |
| InChIKey | OKHKAUPXINIRAE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.03 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |