C16H17NO2 — CID 740547
furan-2-yl-[(3S)-3-phenylpiperidin-1-yl]methanone (PubChem CID 740547) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is furan-2-yl-[(3S)-3-phenylpiperidin-1-yl]methanone.
| Compound Name | furan-2-yl-[(3S)-3-phenylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 740547 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | furan-2-yl-[(3S)-3-phenylpiperidin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCC[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H17NO2/c18-16(15-9-5-11-19-15)17-10-4-8-14(12-17)13-6-2-1-3-7-13/h1-3,5-7,9,11,14H,4,8,10,12H2/t14-/m1/s1 |
| InChIKey | LHNXOHICBYMMGK-CQSZACIVSA-N |
| XLogP | 3.30 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |