C12H13NO6 — CID 112568035
1-(furan-2-carbonyl)piperidine-3,4-dicarboxylic acid (PubChem CID 112568035) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is 1-(furan-2-carbonyl)piperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(furan-2-carbonyl)piperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 112568035 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-(furan-2-carbonyl)piperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2ccco2)CC1C(=O)O |
| InChI | InChI=1S/C12H13NO6/c14-10(9-2-1-5-19-9)13-4-3-7(11(15)16)8(6-13)12(17)18/h1-2,5,7-8H,3-4,6H2,(H,15,16)(H,17,18) |
| InChIKey | KLAUFSQHWLSMPT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |