C10H13NO4S — CID 71805486
furan-2-yl-(3-methylsulfonylpyrrolidin-1-yl)methanone (PubChem CID 71805486) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is furan-2-yl-(3-methylsulfonylpyrrolidin-1-yl)methanone.
| Compound Name | furan-2-yl-(3-methylsulfonylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 71805486 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | furan-2-yl-(3-methylsulfonylpyrrolidin-1-yl)methanone |
| SMILES | CS(=O)(=O)C1CCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C10H13NO4S/c1-16(13,14)8-4-5-11(7-8)10(12)9-3-2-6-15-9/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | ZOIINYNNVMFIGF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |