C29H34N2O3 — CID 45207969
furan-2-yl-[3-[[4-[(4-phenylpiperidin-1-yl)methyl]phenoxy]methyl]piperidin-1-yl]methanone (PubChem CID 45207969) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is furan-2-yl-[3-[[4-[(4-phenylpiperidin-1-yl)methyl]phenoxy]methyl]piperidin-1-yl]methanone.
| Compound Name | furan-2-yl-[3-[[4-[(4-phenylpiperidin-1-yl)methyl]phenoxy]methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 45207969 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | furan-2-yl-[3-[[4-[(4-phenylpiperidin-1-yl)methyl]phenoxy]methyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCCC(COc2ccc(CN3CCC(c4ccccc4)CC3)cc2)C1 |
| InChI | InChI=1S/C29H34N2O3/c32-29(28-9-5-19-33-28)31-16-4-6-24(21-31)22-34-27-12-10-23(11-13-27)20-30-17-14-26(15-18-30)25-7-2-1-3-8-25/h1-3,5,7-13,19,24,26H,4,6,14-18,20-22H2 |
| InChIKey | CGAKWVWNTOWMGA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |