C22H27N3O3 — CID 99855360
[(3S)-1-(furan-2-carbonyl)piperidin-3-yl]-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone (PubChem CID 99855360) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is [(3S)-1-(furan-2-carbonyl)piperidin-3-yl]-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone.
| Compound Name | [(3S)-1-(furan-2-carbonyl)piperidin-3-yl]-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 99855360 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | [(3S)-1-(furan-2-carbonyl)piperidin-3-yl]-[(2S)-4-methyl-2-phenylpiperazin-1-yl]methanone |
| SMILES | CN1CCN(C(=O)[C@H]2CCCN(C(=O)c3ccco3)C2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-23-12-13-25(19(16-23)17-7-3-2-4-8-17)21(26)18-9-5-11-24(15-18)22(27)20-10-6-14-28-20/h2-4,6-8,10,14,18-19H,5,9,11-13,15-16H2,1H3/t18-,19+/m0/s1 |
| InChIKey | KPTHEAMGOZHNTN-RBUKOAKNSA-N |
| XLogP | 2.65 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |