C23H25N3OS2 — CID 58866439
N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]-5-(2-methylsulfanylphenyl)thiophene-2-carboxamide (PubChem CID 58866439) has the molecular formula C23H25N3OS2 and a molecular weight of 423.61 g/mol. Its IUPAC name is N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]-5-(2-methylsulfanylphenyl)thiophene-2-carboxamide.
| Compound Name | N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]-5-(2-methylsulfanylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58866439 |
| Molecular Formula | C23H25N3OS2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[4-[3-(methylamino)pyrrolidin-1-yl]phenyl]-5-(2-methylsulfanylphenyl)thiophene-2-carboxamide |
| SMILES | CNC1CCN(c2ccc(NC(=O)c3ccc(-c4ccccc4SC)s3)cc2)C1 |
| InChI | InChI=1S/C23H25N3OS2/c1-24-17-13-14-26(15-17)18-9-7-16(8-10-18)25-23(27)22-12-11-21(29-22)19-5-3-4-6-20(19)28-2/h3-12,17,24H,13-15H2,1-2H3,(H,25,27) |
| InChIKey | LXLYWHIQKGOIAW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|