C26H31N3O2 — CID 142931129
[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-[4-(4-methoxyphenyl)phenyl]methanol (PubChem CID 142931129) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is [4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-[4-(4-methoxyphenyl)phenyl]methanol.
| Compound Name | [4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-[4-(4-methoxyphenyl)phenyl]methanol |
|---|---|
| PubChem CID | 142931129 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-[4-(4-methoxyphenyl)phenyl]methanol |
| SMILES | COc1ccc(-c2ccc(C(O)Nc3ccc(N4CCC(N(C)C)C4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-28(2)24-16-17-29(18-24)23-12-10-22(11-13-23)27-26(30)21-6-4-19(5-7-21)20-8-14-25(31-3)15-9-20/h4-15,24,26-27,30H,16-18H2,1-3H3 |
| InChIKey | ZGGGLXIKTSLDJZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|