C25H27ClFN3O — CID 142931448
[4-(3-chloro-4-fluorophenyl)phenyl]-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]methanol (PubChem CID 142931448) has the molecular formula C25H27ClFN3O and a molecular weight of 439.96 g/mol. Its IUPAC name is [4-(3-chloro-4-fluorophenyl)phenyl]-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]methanol.
| Compound Name | [4-(3-chloro-4-fluorophenyl)phenyl]-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]methanol |
|---|---|
| PubChem CID | 142931448 |
| Molecular Formula | C25H27ClFN3O |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [4-(3-chloro-4-fluorophenyl)phenyl]-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]methanol |
| SMILES | CN(C)C1CCN(c2ccc(NC(O)c3ccc(-c4ccc(F)c(Cl)c4)cc3)cc2)C1 |
| InChI | InChI=1S/C25H27ClFN3O/c1-29(2)22-13-14-30(16-22)21-10-8-20(9-11-21)28-25(31)18-5-3-17(4-6-18)19-7-12-24(27)23(26)15-19/h3-12,15,22,25,28,31H,13-14,16H2,1-2H3 |
| InChIKey | BCSDHLLMEKGENX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|