C23H30N4O2 — CID 142931112
N-[4-[(E)-3-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-3-hydroxyprop-1-enyl]phenyl]acetamide (PubChem CID 142931112) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-[(E)-3-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-3-hydroxyprop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-3-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-3-hydroxyprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 142931112 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-[4-[(E)-3-[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-3-hydroxyprop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(O)Nc2ccc(N3CCC(N(C)C)C3)cc2)cc1 |
| InChI | InChI=1S/C23H30N4O2/c1-17(28)24-19-7-4-18(5-8-19)6-13-23(29)25-20-9-11-21(12-10-20)27-15-14-22(16-27)26(2)3/h4-13,22-23,25,29H,14-16H2,1-3H3,(H,24,28)/b13-6+ |
| InChIKey | SFQNJVRISNFIEB-AWNIVKPZSA-N |
| XLogP | 3.23 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|