C23H36N4O2 — CID 142931357
cyclobutyl-[4-[[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-hydroxymethyl]piperidin-1-yl]methanone (PubChem CID 142931357) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is cyclobutyl-[4-[[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-hydroxymethyl]piperidin-1-yl]methanone.
| Compound Name | cyclobutyl-[4-[[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-hydroxymethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 142931357 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | cyclobutyl-[4-[[4-[3-(dimethylamino)pyrrolidin-1-yl]anilino]-hydroxymethyl]piperidin-1-yl]methanone |
| SMILES | CN(C)C1CCN(c2ccc(NC(O)C3CCN(C(=O)C4CCC4)CC3)cc2)C1 |
| InChI | InChI=1S/C23H36N4O2/c1-25(2)21-12-15-27(16-21)20-8-6-19(7-9-20)24-22(28)17-10-13-26(14-11-17)23(29)18-4-3-5-18/h6-9,17-18,21-22,24,28H,3-5,10-16H2,1-2H3 |
| InChIKey | PCHUXCJQHGSRSW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|