C28H38N4O3 — CID 58866597
4-(2-methylpropoxy)-N-[4-[3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrrolidin-1-yl]phenyl]benzamide (PubChem CID 58866597) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-N-[4-[3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrrolidin-1-yl]phenyl]benzamide.
| Compound Name | 4-(2-methylpropoxy)-N-[4-[3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrrolidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 58866597 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 4-(2-methylpropoxy)-N-[4-[3-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrrolidin-1-yl]phenyl]benzamide |
| SMILES | CC(C)COc1ccc(C(=O)Nc2ccc(N3CCC(NCCCN4CCCC4=O)C3)cc2)cc1 |
| InChI | InChI=1S/C28H38N4O3/c1-21(2)20-35-26-12-6-22(7-13-26)28(34)30-23-8-10-25(11-9-23)32-18-14-24(19-32)29-15-4-17-31-16-3-5-27(31)33/h6-13,21,24,29H,3-5,14-20H2,1-2H3,(H,30,34) |
| InChIKey | ZBUASLLROJNCKD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|