C26H26FN3O3 — CID 21105593
4-(4-fluorophenoxy)-N-[4-[3-(2-oxopropylamino)pyrrolidin-1-yl]phenyl]benzamide (PubChem CID 21105593) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-(4-fluorophenoxy)-N-[4-[3-(2-oxopropylamino)pyrrolidin-1-yl]phenyl]benzamide.
| Compound Name | 4-(4-fluorophenoxy)-N-[4-[3-(2-oxopropylamino)pyrrolidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 21105593 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-(4-fluorophenoxy)-N-[4-[3-(2-oxopropylamino)pyrrolidin-1-yl]phenyl]benzamide |
| SMILES | CC(=O)CNC1CCN(c2ccc(NC(=O)c3ccc(Oc4ccc(F)cc4)cc3)cc2)C1 |
| InChI | InChI=1S/C26H26FN3O3/c1-18(31)16-28-22-14-15-30(17-22)23-8-6-21(7-9-23)29-26(32)19-2-10-24(11-3-19)33-25-12-4-20(27)5-13-25/h2-13,22,28H,14-17H2,1H3,(H,29,32) |
| InChIKey | MJQJTGJGKNCHTF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|