C20H23FN4O2 — CID 129369399
4-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]-N-methylbenzamide (PubChem CID 129369399) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is 4-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]-N-methylbenzamide.
| Compound Name | 4-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 129369399 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 4-[[(3R)-1-(4-fluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)NC[C@H]2CCN(c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C20H23FN4O2/c1-22-19(26)15-2-6-17(7-3-15)24-20(27)23-12-14-10-11-25(13-14)18-8-4-16(21)5-9-18/h2-9,14H,10-13H2,1H3,(H,22,26)(H2,23,24,27)/t14-/m1/s1 |
| InChIKey | TUOUXHGEOPAPDG-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |