C24H38N4O3 — CID 153372258
(3aR,6aS)-2-(4-ethoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;ethane (PubChem CID 153372258) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is (3aR,6aS)-2-(4-ethoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;ethane.
| Compound Name | (3aR,6aS)-2-(4-ethoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 153372258 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (3aR,6aS)-2-(4-ethoxyphenyl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;ethane |
| SMILES | CC.CCOc1ccc(N2C[C@H]3CN(C(=O)NCCCN4CCCC4=O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C22H32N4O3.C2H6/c1-2-29-20-8-6-19(7-9-20)25-13-17-15-26(16-18(17)14-25)22(28)23-10-4-12-24-11-3-5-21(24)27;1-2/h6-9,17-18H,2-5,10-16H2,1H3,(H,23,28);1-2H3/t17-,18+; |
| InChIKey | CHGBEVNRJCNLLI-GNXQHMNLSA-N |
| XLogP | 3.20 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|