C20H29N3O4S — CID 153372297
(3aR,6aS)-N-(1,1-dioxothian-4-yl)-2-(4-ethoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 153372297) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is (3aR,6aS)-N-(1,1-dioxothian-4-yl)-2-(4-ethoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aR,6aS)-N-(1,1-dioxothian-4-yl)-2-(4-ethoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 153372297 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (3aR,6aS)-N-(1,1-dioxothian-4-yl)-2-(4-ethoxyphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCOc1ccc(N2C[C@H]3CN(C(=O)NC4CCS(=O)(=O)CC4)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C20H29N3O4S/c1-2-27-19-5-3-18(4-6-19)22-11-15-13-23(14-16(15)12-22)20(24)21-17-7-9-28(25,26)10-8-17/h3-6,15-17H,2,7-14H2,1H3,(H,21,24)/t15-,16+ |
| InChIKey | AHYZQGIYMVRICO-IYBDPMFKSA-N |
| XLogP | 1.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|