C13H18N2O4S — CID 61102889
2-(4-aminophenoxy)-N-(1,1-dioxothian-4-yl)acetamide (PubChem CID 61102889) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-(1,1-dioxothian-4-yl)acetamide.
| Compound Name | 2-(4-aminophenoxy)-N-(1,1-dioxothian-4-yl)acetamide |
|---|---|
| PubChem CID | 61102889 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(4-aminophenoxy)-N-(1,1-dioxothian-4-yl)acetamide |
| SMILES | Nc1ccc(OCC(=O)NC2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c14-10-1-3-12(4-2-10)19-9-13(16)15-11-5-7-20(17,18)8-6-11/h1-4,11H,5-9,14H2,(H,15,16) |
| InChIKey | UONXXWBJJFLNBD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|