C25H31ClN4O2 — CID 42437735
3-chloro-N-[4-[4-[3-(2-oxopyrrolidin-1-yl)propylamino]piperidin-1-yl]phenyl]benzamide (PubChem CID 42437735) has the molecular formula C25H31ClN4O2 and a molecular weight of 455.00 g/mol. Its IUPAC name is 3-chloro-N-[4-[4-[3-(2-oxopyrrolidin-1-yl)propylamino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[4-[3-(2-oxopyrrolidin-1-yl)propylamino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42437735 |
| Molecular Formula | C25H31ClN4O2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 3-chloro-N-[4-[4-[3-(2-oxopyrrolidin-1-yl)propylamino]piperidin-1-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(NCCCN3CCCC3=O)CC2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H31ClN4O2/c26-20-5-1-4-19(18-20)25(32)28-22-7-9-23(10-8-22)29-16-11-21(12-17-29)27-13-3-15-30-14-2-6-24(30)31/h1,4-5,7-10,18,21,27H,2-3,6,11-17H2,(H,28,32) |
| InChIKey | XNZLMLHMQMSNKE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|