C17H22ClN3O3 — CID 55694248
3-chloro-N-[2-oxo-2-[2-(2-oxoazepan-1-yl)ethylamino]ethyl]benzamide (PubChem CID 55694248) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-[2-(2-oxoazepan-1-yl)ethylamino]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-oxo-2-[2-(2-oxoazepan-1-yl)ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 55694248 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-[2-(2-oxoazepan-1-yl)ethylamino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)NCCN1CCCCCC1=O |
| InChI | InChI=1S/C17H22ClN3O3/c18-14-6-4-5-13(11-14)17(24)20-12-15(22)19-8-10-21-9-3-1-2-7-16(21)23/h4-6,11H,1-3,7-10,12H2,(H,19,22)(H,20,24) |
| InChIKey | MVXBVXGFKRMCIZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |