C17H20Cl2N4O4 — CID 9218955
3,4-dichloro-N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]benzamide (PubChem CID 9218955) has the molecular formula C17H20Cl2N4O4 and a molecular weight of 415.28 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 9218955 |
| Molecular Formula | C17H20Cl2N4O4 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 3,4-dichloro-N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C17H20Cl2N4O4/c18-12-6-5-11(8-13(12)19)17(27)20-9-14(24)21-22-15(25)10-23-7-3-1-2-4-16(23)26/h5-6,8H,1-4,7,9-10H2,(H,20,27)(H,21,24)(H,22,25) |
| InChIKey | IZCPNTABMRKUJK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|