C15H20N4O5 — CID 9218953
N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]furan-2-carboxamide (PubChem CID 9218953) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9218953 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[2-oxo-2-[2-[2-(2-oxoazepan-1-yl)acetyl]hydrazinyl]ethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C15H20N4O5/c20-12(9-16-15(23)11-5-4-8-24-11)17-18-13(21)10-19-7-3-1-2-6-14(19)22/h4-5,8H,1-3,6-7,9-10H2,(H,16,23)(H,17,20)(H,18,21) |
| InChIKey | RORXQABSUIHKSM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|