C17H23N3O3 — CID 9218984
N'-[2-(2-oxoazepan-1-yl)acetyl]-3-phenylpropanehydrazide (PubChem CID 9218984) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N'-[2-(2-oxoazepan-1-yl)acetyl]-3-phenylpropanehydrazide.
| Compound Name | N'-[2-(2-oxoazepan-1-yl)acetyl]-3-phenylpropanehydrazide |
|---|---|
| PubChem CID | 9218984 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N'-[2-(2-oxoazepan-1-yl)acetyl]-3-phenylpropanehydrazide |
| SMILES | O=C(CCc1ccccc1)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C17H23N3O3/c21-15(11-10-14-7-3-1-4-8-14)18-19-16(22)13-20-12-6-2-5-9-17(20)23/h1,3-4,7-8H,2,5-6,9-13H2,(H,18,21)(H,19,22) |
| InChIKey | BWTMODLAAXKZQD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|