C30H34N2O4 — CID 142011046
N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 142011046) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 142011046 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | N-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | O=C(CN1CCCCCC1=O)NCCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H34N2O4/c33-29(21-32-19-9-3-8-14-30(32)34)31-18-17-24-15-16-27(35-22-25-10-4-1-5-11-25)28(20-24)36-23-26-12-6-2-7-13-26/h1-2,4-7,10-13,15-16,20H,3,8-9,14,17-19,21-23H2,(H,31,33) |
| InChIKey | WWJGWMOEFKYVLK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |