C20H24N6O3 — CID 9093077
(E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2-oxoazepan-1-yl)acetyl]prop-2-enehydrazide (PubChem CID 9093077) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2-oxoazepan-1-yl)acetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2-oxoazepan-1-yl)acetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9093077 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2-oxoazepan-1-yl)acetyl]prop-2-enehydrazide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nn1)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C20H24N6O3/c27-18(22-23-19(28)15-25-12-6-2-5-9-20(25)29)11-10-17-14-26(24-21-17)13-16-7-3-1-4-8-16/h1,3-4,7-8,10-11,14H,2,5-6,9,12-13,15H2,(H,22,27)(H,23,28)/b11-10+ |
| InChIKey | REULSPFNMVRVMX-ZHACJKMWSA-N |
| XLogP | 0.89 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|