C17H22N6OS — CID 9088915
1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-tert-butylthiourea (PubChem CID 9088915) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-tert-butylthiourea.
| Compound Name | 1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-tert-butylthiourea |
|---|---|
| PubChem CID | 9088915 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-3-tert-butylthiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)/C=C/c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C17H22N6OS/c1-17(2,3)18-16(25)21-20-15(24)10-9-14-12-23(22-19-14)11-13-7-5-4-6-8-13/h4-10,12H,11H2,1-3H3,(H,20,24)(H2,18,21,25)/b10-9+ |
| InChIKey | CMWMFYHCWIKUMD-MDZDMXLPSA-N |
| XLogP | 1.63 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|