About (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide
(E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide (PubChem CID 9087576) has the molecular formula C22H23N5O3
and a molecular weight of 405.46 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide |
| PubChem CID | 9087576 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)/C=C/c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C22H23N5O3/c1-16-7-6-8-17(2)22(16)30-15-21(29)25-24-20(28)12-11-19-14-27(26-23-19)13-18-9-4-3-5-10-18/h3-12,14H,13,15H2,1-2H3,(H,24,28)(H,25,29)/b12-11+ |
| InChIKey | ZEMBBCJSCHWSFJ-VAWYXSNFSA-N |
| XLogP | 2.18 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide?
The IUPAC name of (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide (CID 9087576) is (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide.
What is the SMILES notation for (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide?
The canonical SMILES for (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide is Cc1cccc(C)c1OCC(=O)NNC(=O)/C=C/c1cn(Cc2ccccc2)nn1.
What is the InChIKey of (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide?
The InChIKey is ZEMBBCJSCHWSFJ-VAWYXSNFSA-N. The full InChI is InChI=1S/C22H23N5O3/c1-16-7-6-8-17(2)22(16)30-15-21(29)25-24-20(28)12-11-19-14-27(26-23-19)13-18-9-4-3-5-10-18/h3-12,14H,13,15H2,1-2H3,(H,24,28)(H,25,29)/b12-11+.
What are the key properties of (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide?
(E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide has a molecular weight of 405.46 g/mol, XLogP of 2.18, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1-benzyltriazol-4-yl)-N'-[2-(2,6-dimethylphenoxy)acetyl]prop-2-enehydrazide is sourced from PubChem (CID 9087576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).